CAS 99012-40-5 is the registry number for 7-Pentyl-9H-fluoren-2-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-pentyl-9H-fluoren-2-ol (CAS 99012-40-5) is a chemical compound with the molecular formula C18H20O and a molecular weight of 252.3 g/mol. IUPAC name: 7-pentyl-9H-fluoren-2-ol. InChIKey: KVLMFEDZEZXVBC-UHFFFAOYSA-N.
| Molecular formula | C18H20O |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 7-pentyl-9H-fluoren-2-ol |
| InChIKey | KVLMFEDZEZXVBC-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)O |
Computed by PubChem (NCBI)