CAS 189084-65-9 is the registry number for 1,2,3,4,5-Pentabromo-6-phenoxybenzene. Offered by: TRC. Available pack sizes: 100mg.
1,2,3,4,5-pentabromo-6-phenoxybenzene (CAS 189084-65-9) is a chemical compound with the molecular formula C12H5Br5O and a molecular weight of 564.7 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-phenoxybenzene. InChIKey: ACRQLFSHISNWRY-UHFFFAOYSA-N.
| Molecular formula | C12H5Br5O |
|---|---|
| Molecular weight | 564.7 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-phenoxybenzene |
| InChIKey | ACRQLFSHISNWRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)