CAS 189084-66-0 appears in our catalog under these names: PBDE 119, PBDE No. 119, BDE 119, 50G/ML IN ISOOCTANE, OEKANAL. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: 5mg, 50mg, 1ML.
1,3,5-tribromo-2-(3,4-dibromophenoxy)benzene (CAS 189084-66-0) is a chemical compound with the molecular formula C12H5Br5O and a molecular weight of 564.7 g/mol. IUPAC name: 1,3,5-tribromo-2-(3,4-dibromophenoxy)benzene. InChIKey: KXEOYBYEJCRPGB-UHFFFAOYSA-N.
| Molecular formula | C12H5Br5O |
|---|---|
| Molecular weight | 564.7 g/mol |
| IUPAC name | 1,3,5-tribromo-2-(3,4-dibromophenoxy)benzene |
| InChIKey | KXEOYBYEJCRPGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)