Products 189101-43-7

CAS 189101-43-7 is the registry number for (1R,2S)-2-Aminocyclohexanecarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid (CAS 189101-43-7) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid. InChIKey: USQHEVWOPJDAAX-RITPCOANSA-N.

Identity
Molecular formulaC7H13NO2
Molecular weight143.18 g/mol
IUPAC namecis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid
InChIKeyUSQHEVWOPJDAAX-RITPCOANSA-N
SMILESC1CC[C@@H]([C@@H](C1)C(=O)O)N

Computed by PubChem (NCBI)