CAS 2387600-69-1 is the registry number for 8-Bromo-3-methyl-5H-thiazolo[3,2-a]pyridin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-3-methyl-[1,3]thiazolo[3,2-a]pyridin-5-one (CAS 2387600-69-1) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: 8-bromo-3-methyl-[1,3]thiazolo[3,2-a]pyridin-5-one. InChIKey: HPVCKBFHLFLZAS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 8-bromo-3-methyl-[1,3]thiazolo[3,2-a]pyridin-5-one |
| InChIKey | HPVCKBFHLFLZAS-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=C(C=CC(=O)N12)Br |
Computed by PubChem (NCBI)