CAS 1891148-76-7 is the registry number for 2-Hydroxy-5-methoxy-beta,beta-dimethyl-benzeneethanol. Offered by: TRC. Available pack sizes: 250mg.
2-(1-hydroxy-2-methylpropan-2-yl)-4-methoxyphenol (CAS 1891148-76-7) is a chemical compound with the molecular formula C11H16O3 and a molecular weight of 196.24 g/mol. IUPAC name: 2-(1-hydroxy-2-methylpropan-2-yl)-4-methoxyphenol. InChIKey: OMXKYVRRAYQLOA-UHFFFAOYSA-N.
| Molecular formula | C11H16O3 |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 2-(1-hydroxy-2-methylpropan-2-yl)-4-methoxyphenol |
| InChIKey | OMXKYVRRAYQLOA-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1=C(C=CC(=C1)OC)O |
Computed by PubChem (NCBI)