Products 189214-39-9
CAS 189214-39-9 is the registry number for 4-fluoro-2-(4-methoxyphenoxy)-1-nitrobenzene, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-fluoro-2-(4-methoxyphenoxy)-1-nitrobenzene (CAS 189214-39-9) is a chemical compound with the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. IUPAC name: 4-fluoro-2-(4-methoxyphenoxy)-1-nitrobenzene. InChIKey: LRXHYUBORPQJSQ-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO4 |
|---|---|
| Molecular weight | 263.22 g/mol |
| IUPAC name | 4-fluoro-2-(4-methoxyphenoxy)-1-nitrobenzene |
| InChIKey | LRXHYUBORPQJSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=C(C=CC(=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)