Products 2205006-23-9
CAS 2205006-23-9 is the registry number for SARS-CoV-2 Mpro-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-fluorophenyl)-3,4,5-trihydroxybenzamide (CAS 2205006-23-9) is a chemical compound with the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. IUPAC name: N-(4-fluorophenyl)-3,4,5-trihydroxybenzamide. InChIKey: UBSSJPGRSOKUBV-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO4 |
|---|---|
| Molecular weight | 263.22 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3,4,5-trihydroxybenzamide |
| InChIKey | UBSSJPGRSOKUBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=CC(=C(C(=C2)O)O)O)F |
Computed by PubChem (NCBI)
Synonyms:
SARS-CoV-2 Mpro-IN-25, orb2665187