CAS 189252-20-8 appears in our catalog under these names: Benzenamine, 4-methyl-2,6-bis(1-phenylethenyl)-, 4-Methyl-2,6-bis(1-phenylethenyl)benzenamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-methyl-2,6-bis(1-phenylethenyl)aniline (CAS 189252-20-8) is a chemical compound with the molecular formula C23H21N and a molecular weight of 311.4 g/mol. IUPAC name: 4-methyl-2,6-bis(1-phenylethenyl)aniline. InChIKey: ABOQIONYESZBJL-UHFFFAOYSA-N.
| Molecular formula | C23H21N |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 4-methyl-2,6-bis(1-phenylethenyl)aniline |
| InChIKey | ABOQIONYESZBJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=C)C2=CC=CC=C2)N)C(=C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)