CAS 2363787-44-2 is the registry number for 9,9-Dimethyl-10-(4-vinylphenyl)-9,10-dihydroacridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
10-(4-ethenylphenyl)-9,9-dimethylacridine (CAS 2363787-44-2) is a chemical compound with the molecular formula C23H21N and a molecular weight of 311.4 g/mol. IUPAC name: 10-(4-ethenylphenyl)-9,9-dimethylacridine. InChIKey: GBQYVEMOFYKZKL-UHFFFAOYSA-N.
| Molecular formula | C23H21N |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 10-(4-ethenylphenyl)-9,9-dimethylacridine |
| InChIKey | GBQYVEMOFYKZKL-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C3=CC=CC=C31)C4=CC=C(C=C4)C=C)C |
Computed by PubChem (NCBI)