CAS 189255-79-6 appears in our catalog under these names: Medetomidine Impurity 42, 3-((1S)-1-(1H-Imidazol-5-yl)ethyl)-2-methylbenzenemethanol. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methanol (CAS 189255-79-6) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: [3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methanol. InChIKey: HTQCEFAVROSRIW-JTQLQIEISA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | [3-[(1S)-1-(1H-imidazol-5-yl)ethyl]-2-methylphenyl]methanol |
| InChIKey | HTQCEFAVROSRIW-JTQLQIEISA-N |
| SMILES | CC1=C(C=CC=C1[C@H](C)C2=CN=CN2)CO |
Computed by PubChem (NCBI)