Products 189264-47-9
CAS 189264-47-9 is the registry number for Cleroindicin F. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(3aR,7aR)-3a-hydroxy-2,3,7,7a-tetrahydro-1-benzofuran-6-one (CAS 189264-47-9) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (3aR,7aR)-3a-hydroxy-2,3,7,7a-tetrahydro-1-benzofuran-6-one. InChIKey: HSGPAWIMHOPPDA-SFYZADRCSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (3aR,7aR)-3a-hydroxy-2,3,7,7a-tetrahydro-1-benzofuran-6-one |
| InChIKey | HSGPAWIMHOPPDA-SFYZADRCSA-N |
| SMILES | C1CO[C@H]2[C@@]1(C=CC(=O)C2)O |
Computed by PubChem (NCBI)