Products 1892953-71-7
CAS 1892953-71-7 is the registry number for 2-(4-(Trifluoromethyl)phenoxy)thiazole-5-carboxylic acid, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-[4-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carboxylic acid (CAS 1892953-71-7) is a chemical compound with the molecular formula C11H6F3NO3S and a molecular weight of 289.23 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carboxylic acid. InChIKey: UKJWGJKGSJHDKZ-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3S |
|---|---|
| Molecular weight | 289.23 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenoxy]-1,3-thiazole-5-carboxylic acid |
| InChIKey | UKJWGJKGSJHDKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)