CAS 886368-65-6 appears in our catalog under these names: 2-(4-Trifluoromethoxy-phenyl)-thiazole-4-carboxylic acid, 95%, 2-(4-(Trifluoromethoxy)phenyl)thiazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid (CAS 886368-65-6) is a chemical compound with the molecular formula C11H6F3NO3S and a molecular weight of 289.23 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid. InChIKey: LVFNYXNUAQRSFP-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3S |
|---|---|
| Molecular weight | 289.23 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | LVFNYXNUAQRSFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)