Products 1893054-22-2
CAS 1893054-22-2 appears in our catalog under these names: Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate, 95%, benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalic acid, 97%, 97%, Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalic acid. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 10g, 25g, 5g, 5 g, 10 g, 100 mg.
Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid (CAS 1893054-22-2) is a chemical compound with the molecular formula C15H18N2O6 and a molecular weight of 322.31 g/mol. IUPAC name: benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid. InChIKey: PLOQOWMRYIXTBH-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O6 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid |
| InChIKey | PLOQOWMRYIXTBH-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C(=O)OCC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate, benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid, Benzyl2,6-diazaspiro[3.3]heptane-2-carboxylateoxalate, Benzyl 2,6-diazaspiro[3.3]heptane-6-carboxylate; oxalic acid, orb3175331, Oxalic acid--benzyl 2,6-diazaspiro[3.3]heptane-2-carb, Oxalic acid--benzyl 2,6-diazaspiro[3.3]heptane-2-carboxylate (1/1)