Products 424811-77-8

CAS 424811-77-8 is the registry number for 2-((2-Methoxy-5-nitrophenyl)carbamoyl)cyclohexane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 424811-77-8) is a chemical compound with the molecular formula C15H18N2O6 and a molecular weight of 322.31 g/mol. IUPAC name: 2-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: OVDFQGROIAILDM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O6
Molecular weight322.31 g/mol
IUPAC name2-[(2-methoxy-5-nitrophenyl)carbamoyl]cyclohexane-1-carboxylic acid
InChIKeyOVDFQGROIAILDM-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)C2CCCCC2C(=O)O

Computed by PubChem (NCBI)