CAS 1893851-99-4 is the registry number for tert-Butyl N-(3-(aminomethyl)-5-fluorophenyl)carbamate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl N-[3-(aminomethyl)-5-fluorophenyl]carbamate (CAS 1893851-99-4) is a chemical compound with the molecular formula C12H17FN2O2 and a molecular weight of 240.27 g/mol. IUPAC name: tert-butyl N-[3-(aminomethyl)-5-fluorophenyl]carbamate. InChIKey: KMNZOOXPIJZDBQ-UHFFFAOYSA-N.
| Molecular formula | C12H17FN2O2 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | tert-butyl N-[3-(aminomethyl)-5-fluorophenyl]carbamate |
| InChIKey | KMNZOOXPIJZDBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)CN)F |
Computed by PubChem (NCBI)