CAS 2702505-11-9 is the registry number for (2-Fluoro-4-nitrophenyl)di-n-propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-fluoro-4-nitro-N,N-dipropylaniline (CAS 2702505-11-9) is a chemical compound with the molecular formula C12H17FN2O2 and a molecular weight of 240.27 g/mol. IUPAC name: 2-fluoro-4-nitro-N,N-dipropylaniline. InChIKey: UAJNPQAJLZZEED-UHFFFAOYSA-N.
| Molecular formula | C12H17FN2O2 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 2-fluoro-4-nitro-N,N-dipropylaniline |
| InChIKey | UAJNPQAJLZZEED-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)