Products 1895-97-2
CAS 1895-97-2 appears in our catalog under these names: (2E)-2-Methyl-3-phenyl-2-propenoic acid, 98%(GC-MS),RG, 98%(GC-MS),RG, (E)-α-Methylcinnamic acid, (E)-alpha-Methylcinnamic Acid, >98.0%(GC)(T). Offered by: Chemat, Biosynth, TCI. Available pack sizes: 5g, 25g, 1g, 0,25g, 2,5g.
(E)-2-methyl-3-phenylprop-2-enoic acid (CAS 1895-97-2) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: (E)-2-methyl-3-phenylprop-2-enoic acid. InChIKey: XNCRUNXWPDJHGV-BQYQJAHWSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (E)-2-methyl-3-phenylprop-2-enoic acid |
| InChIKey | XNCRUNXWPDJHGV-BQYQJAHWSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
ALPHA-METHYLCINNAMIC ACID, 2-methyl-3-phenylacrylic acid, (E)-2-methyl-3-phenylacrylic acid, (2E)-2-methyl-3-phenylprop-2-enoic acid, 2-Methyl-3-phenyl-2-propenoic acid, 2-Propenoic acid, 2-methyl-3-phenyl-, (2E)-, (E)-2-methyl-3-phenylprop-2-enoic acid, 2-Propenoic acid, 2-methyl-3-phenyl-, Cinnamic acid, .alpha.-methyl-, (e)-2-methylcinnamic acid