CAS 1895082-15-1 is the registry number for 1-(2,2-Dimethyl-3,4-dihydro-2H-1-benzopyran-6-yl)propan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propan-2-ol (CAS 1895082-15-1) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propan-2-ol. InChIKey: BTMGYHSOGFTNOE-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1-(2,2-dimethyl-3,4-dihydrochromen-6-yl)propan-2-ol |
| InChIKey | BTMGYHSOGFTNOE-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OC(CC2)(C)C)O |
Computed by PubChem (NCBI)