CAS 1895253-52-7 appears in our catalog under these names: 1-(4-Iodophenyl)cyclopentanemethanamine, 95%, (1-(4-Iodophenyl)cyclopentyl)methanamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[1-(4-iodophenyl)cyclopentyl]methanamine (CAS 1895253-52-7) is a chemical compound with the molecular formula C12H16IN and a molecular weight of 301.17 g/mol. IUPAC name: [1-(4-iodophenyl)cyclopentyl]methanamine. InChIKey: DNVGWJCYAAJTRW-UHFFFAOYSA-N.
| Molecular formula | C12H16IN |
|---|---|
| Molecular weight | 301.17 g/mol |
| IUPAC name | [1-(4-iodophenyl)cyclopentyl]methanamine |
| InChIKey | DNVGWJCYAAJTRW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CN)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)