CAS 5418-63-3 appears in our catalog under these names: 1,2,3,3-Tetramethyl-3h-indolium iodide, 97%, 1,2,3,3–tetramethyl–3H–indolium iodide, 1,2,3,3-Tetramethyl-3H-indolium Iodide, >98.0%(HPLC)(T), 1,2,3,3-Tetramethyl-3H-indolium iodide 98%, 1,2,3,3-TETRAMETHYL-3H-INDOLIUM IODIDE,&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 500g, 1000g, 1kg.
1,2,3,3-tetramethylindol-1-ium iodide (CAS 5418-63-3) is a chemical compound with the molecular formula C12H16IN and a molecular weight of 301.17 g/mol. IUPAC name: 1,2,3,3-tetramethylindol-1-ium iodide. InChIKey: HCYIOKVZAATOEW-UHFFFAOYSA-M.
| Molecular formula | C12H16IN |
|---|---|
| Molecular weight | 301.17 g/mol |
| IUPAC name | 1,2,3,3-tetramethylindol-1-ium iodide |
| InChIKey | HCYIOKVZAATOEW-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=CC=CC=C2C1(C)C)C.[I-] |
Computed by PubChem (NCBI)