Products 1895748-91-0

CAS 1895748-91-0 is the registry number for Methyl 3-azabicyclo(4.1.0)heptane-1-carboxylate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Methyl 3-azabicyclo[4.1.0]heptane-1-carboxylate;hydrochloride (CAS 1895748-91-0) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl 3-azabicyclo[4.1.0]heptane-1-carboxylate;hydrochloride. InChIKey: MDEDXJZMSXDUDL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC namemethyl 3-azabicyclo[4.1.0]heptane-1-carboxylate;hydrochloride
InChIKeyMDEDXJZMSXDUDL-UHFFFAOYSA-N
SMILESCOC(=O)C12CC1CCNC2.Cl

Computed by PubChem (NCBI)