Products 1895766-22-9
CAS 1895766-22-9 is the registry number for 5H-Pyrido[4,3-b]indole-8-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5H-pyrido[4,3-b]indole-8-carbonitrile (CAS 1895766-22-9) is a chemical compound with the molecular formula C12H7N3 and a molecular weight of 193.20 g/mol. IUPAC name: 5H-pyrido[4,3-b]indole-8-carbonitrile. InChIKey: BFMQZPVWRJSCRZ-UHFFFAOYSA-N.
| Molecular formula | C12H7N3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 5H-pyrido[4,3-b]indole-8-carbonitrile |
| InChIKey | BFMQZPVWRJSCRZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C3=C(N2)C=CN=C3 |
Computed by PubChem (NCBI)