CAS 26066-90-0 is the registry number for 1H-Pyrido[2,3-b]indole-6-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9H-pyrido[2,3-b]indole-6-carbonitrile (CAS 26066-90-0) is a chemical compound with the molecular formula C12H7N3 and a molecular weight of 193.20 g/mol. IUPAC name: 9H-pyrido[2,3-b]indole-6-carbonitrile. InChIKey: WNICATRXNHZBPI-UHFFFAOYSA-N.
| Molecular formula | C12H7N3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 9H-pyrido[2,3-b]indole-6-carbonitrile |
| InChIKey | WNICATRXNHZBPI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC3=C2C=C(C=C3)C#N)N=C1 |
Computed by PubChem (NCBI)