CAS 101685-29-4 appears in our catalog under these names: 2-Phenylprop-1-ene-1,1,3-tricarbonitrile 95%, 2-Phenylprop-1-ene-1,1,3-tricarbonitrile, 95%, 95%, 2-PHENYLPROP-1-ENE-1,1,3-TRICARBONITRILE, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-phenylprop-1-ene-1,1,3-tricarbonitrile (CAS 101685-29-4) is a chemical compound with the molecular formula C12H7N3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-phenylprop-1-ene-1,1,3-tricarbonitrile. InChIKey: OKGPOSFUSLYERN-UHFFFAOYSA-N.
| Molecular formula | C12H7N3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-phenylprop-1-ene-1,1,3-tricarbonitrile |
| InChIKey | OKGPOSFUSLYERN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C#N)C#N)CC#N |
Computed by PubChem (NCBI)