Products 1896339-59-5
CAS 1896339-59-5 appears in our catalog under these names: 4-Chloro-2-methoxy-α,α-dimethylbenzenemethanol, 95%, 2-(4-Chloro-2-methoxyphenyl)propan-2-ol, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(4-chloro-2-methoxyphenyl)propan-2-ol (CAS 1896339-59-5) is a chemical compound with the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. IUPAC name: 2-(4-chloro-2-methoxyphenyl)propan-2-ol. InChIKey: PTVCGOSFYOFWGT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO2 |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | 2-(4-chloro-2-methoxyphenyl)propan-2-ol |
| InChIKey | PTVCGOSFYOFWGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)Cl)OC)O |
Computed by PubChem (NCBI)