Products 189634-91-1
CAS 189634-91-1 is the registry number for 1-Benzyl-7-bromo-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-benzyl-7-bromoindole (CAS 189634-91-1) is a chemical compound with the molecular formula C15H12BrN and a molecular weight of 286.17 g/mol. IUPAC name: 1-benzyl-7-bromoindole. InChIKey: CTPWWPHZSVXATM-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 1-benzyl-7-bromoindole |
| InChIKey | CTPWWPHZSVXATM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)