CAS 481630-30-2 appears in our catalog under these names: 1-Benzyl-6-bromo-1H-indole, 98%, 1-Benzyl-6-bromo-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-benzyl-6-bromoindole (CAS 481630-30-2) is a chemical compound with the molecular formula C15H12BrN and a molecular weight of 286.17 g/mol. IUPAC name: 1-benzyl-6-bromoindole. InChIKey: UQGNSLYYFIRZOM-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN |
|---|---|
| Molecular weight | 286.17 g/mol |
| IUPAC name | 1-benzyl-6-bromoindole |
| InChIKey | UQGNSLYYFIRZOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)