Products 1896382-67-4
CAS 1896382-67-4 is the registry number for 1-(tert-Butylsulfonyl)-5,5-dimethylpyrrolidin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butylsulfonyl-5,5-dimethylpyrrolidin-3-one (CAS 1896382-67-4) is a chemical compound with the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. IUPAC name: 1-tert-butylsulfonyl-5,5-dimethylpyrrolidin-3-one. InChIKey: JNDFGFHOIUFQID-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 1-tert-butylsulfonyl-5,5-dimethylpyrrolidin-3-one |
| InChIKey | JNDFGFHOIUFQID-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CN1S(=O)(=O)C(C)(C)C)C |
Computed by PubChem (NCBI)