CAS 70155-90-7 is the registry number for Deps, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate (CAS 70155-90-7) is a chemical compound with the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. IUPAC name: 3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate. InChIKey: XTPJLNSARGBDNC-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate |
| InChIKey | XTPJLNSARGBDNC-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CCCS(=O)(=O)[O-])CC#C |
Computed by PubChem (NCBI)