Products 1896533-40-6
CAS 1896533-40-6 appears in our catalog under these names: 3-(Piperidin-2-yl)phenol hydrochloride, 3-(piperidin-2-yl)phenol hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
3-piperidin-2-ylphenol;hydrochloride (CAS 1896533-40-6) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-piperidin-2-ylphenol;hydrochloride. InChIKey: CQWQCQZQXDNUEM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-piperidin-2-ylphenol;hydrochloride |
| InChIKey | CQWQCQZQXDNUEM-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)