CAS 18966-64-8 is the registry number for 2-Bromo-4-(2-methylbutan-2-yl)phenol. Offered by: TRC. Available pack sizes: 100mg.
2-bromo-4-(2-methylbutan-2-yl)phenol (CAS 18966-64-8) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 2-bromo-4-(2-methylbutan-2-yl)phenol. InChIKey: LTEAOSLAFBPTDU-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 2-bromo-4-(2-methylbutan-2-yl)phenol |
| InChIKey | LTEAOSLAFBPTDU-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=C(C=C1)O)Br |
Computed by PubChem (NCBI)