Products 1896752-94-5
CAS 1896752-94-5 is the registry number for 2-(Trifluoromethyl)bicyclo(2.2.1)heptane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1896752-94-5) is a chemical compound with the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. IUPAC name: 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: RFPCQKBCFSEPOA-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O2 |
|---|---|
| Molecular weight | 208.18 g/mol |
| IUPAC name | 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | RFPCQKBCFSEPOA-UHFFFAOYSA-N |
| SMILES | C1CC2CC1CC2(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)