Products 952403-55-3

CAS 952403-55-3 is the registry number for 4-(Trifluoromethyl)bicyclo(2.2.1)heptane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(trifluoromethyl)bicyclo[2.2.1]heptane-1-carboxylic acid (CAS 952403-55-3) is a chemical compound with the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. IUPAC name: 4-(trifluoromethyl)bicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: WJDGZRZVDQRWCU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11F3O2
Molecular weight208.18 g/mol
IUPAC name4-(trifluoromethyl)bicyclo[2.2.1]heptane-1-carboxylic acid
InChIKeyWJDGZRZVDQRWCU-UHFFFAOYSA-N
SMILESC1CC2(CCC1(C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)