CAS 189696-30-8 appears in our catalog under these names: 2,6-Di-tert-butyl-4-((1s,4r)-4-propylcyclohexyl)phenol 97%, 2,6-bis(1,1-dimethylethyl)-4-(trans-4-propylcyclohexyl)-Phenol, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
2,6-ditert-butyl-4-(4-propylcyclohexyl)phenol (CAS 189696-30-8) is a chemical compound with the molecular formula C23H38O and a molecular weight of 330.5 g/mol. IUPAC name: 2,6-ditert-butyl-4-(4-propylcyclohexyl)phenol. InChIKey: PBEMFWGJRHQMEI-UHFFFAOYSA-N.
| Molecular formula | C23H38O |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(4-propylcyclohexyl)phenol |
| InChIKey | PBEMFWGJRHQMEI-UHFFFAOYSA-N |
| SMILES | CCCC1CCC(CC1)C2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)