Products 3879-24-1
CAS 3879-24-1 appears in our catalog under these names: Teprenone Impurity 7, (5Z,9Z,13E)-Geranylgeranylacetone. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 1mg.
(5Z,9Z,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one (CAS 3879-24-1) is a chemical compound with the molecular formula C23H38O and a molecular weight of 330.5 g/mol. IUPAC name: (5Z,9Z,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one. InChIKey: HUCXKZBETONXFO-NMILVPMLSA-N.
| Molecular formula | C23H38O |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | (5Z,9Z,13E)-6,10,14,18-tetramethylnonadeca-5,9,13,17-tetraen-2-one |
| InChIKey | HUCXKZBETONXFO-NMILVPMLSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C\CC/C(=C\CCC(=O)C)/C)/C)/C)C |
Computed by PubChem (NCBI)