Products 18982-90-6
CAS 18982-90-6 is the registry number for 4-(tert-Butyl)-1,2-dichlorobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-tert-butyl-1,2-dichlorobenzene (CAS 18982-90-6) is a chemical compound with the molecular formula C10H12Cl2 and a molecular weight of 203.10 g/mol. IUPAC name: 4-tert-butyl-1,2-dichlorobenzene. InChIKey: ATUOYXFVUMWRHF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 4-tert-butyl-1,2-dichlorobenzene |
| InChIKey | ATUOYXFVUMWRHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)