Products 4126-83-4
CAS 4126-83-4 is the registry number for 2-(Dichloromethyl)-1,3,5-trimethylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(dichloromethyl)-1,3,5-trimethylbenzene (CAS 4126-83-4) is a chemical compound with the molecular formula C10H12Cl2 and a molecular weight of 203.10 g/mol. IUPAC name: 2-(dichloromethyl)-1,3,5-trimethylbenzene. InChIKey: NLYCXOWHQJCNKC-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2 |
|---|---|
| Molecular weight | 203.10 g/mol |
| IUPAC name | 2-(dichloromethyl)-1,3,5-trimethylbenzene |
| InChIKey | NLYCXOWHQJCNKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(Cl)Cl)C |
Computed by PubChem (NCBI)