CAS 1898232-70-6 appears in our catalog under these names: SC428, SC428, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 1 mg, 10 mg, 5 mg, 10mM/1mL, 25 mg, 50 mg.
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(E)-2-thiophen-2-ylethenyl]urea (CAS 1898232-70-6) is a chemical compound with the molecular formula C15H10F3N3OS and a molecular weight of 337.3 g/mol. IUPAC name: 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(E)-2-thiophen-2-ylethenyl]urea. InChIKey: KACLJUCCGUSGNY-AATRIKPKSA-N.
| Molecular formula | C15H10F3N3OS |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(E)-2-thiophen-2-ylethenyl]urea |
| InChIKey | KACLJUCCGUSGNY-AATRIKPKSA-N |
| SMILES | C1=CSC(=C1)/C=C/NC(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F |
Computed by PubChem (NCBI)