Products 23750-73-4
CAS 23750-73-4 is the registry number for Anti-MRSA agent 27. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea (CAS 23750-73-4) is a chemical compound with the molecular formula C15H10F3N3OS and a molecular weight of 337.3 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea. InChIKey: MUDXNMBQUFEFLH-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N3OS |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| InChIKey | MUDXNMBQUFEFLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Anti-MRSA agent 27, orb3028016