Products 1899025-43-4
CAS 1899025-43-4 is the registry number for Tyrosinase-IN-37. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-3-[3-(4-methylphenyl)pyrazol-1-yl]-1H-1,2,4-triazole-5-thione (CAS 1899025-43-4) is a chemical compound with the molecular formula C12H12N6S and a molecular weight of 272.33 g/mol. IUPAC name: 4-amino-3-[3-(4-methylphenyl)pyrazol-1-yl]-1H-1,2,4-triazole-5-thione. InChIKey: IEVMCRDTZBTGGA-UHFFFAOYSA-N.
| Molecular formula | C12H12N6S |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 4-amino-3-[3-(4-methylphenyl)pyrazol-1-yl]-1H-1,2,4-triazole-5-thione |
| InChIKey | IEVMCRDTZBTGGA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C=C2)C3=NNC(=S)N3N |
Computed by PubChem (NCBI)
Synonyms:
Tyrosinase-IN-37, orb2665017