CAS 319932-17-7 is the registry number for 5-(Methylthio)-2-(m-tolyl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (CAS 319932-17-7) is a chemical compound with the molecular formula C12H12N6S and a molecular weight of 272.33 g/mol. IUPAC name: 2-(3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine. InChIKey: ZFCMNIMBEFAUFG-UHFFFAOYSA-N.
| Molecular formula | C12H12N6S |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 2-(3-methylphenyl)-5-methylsulfanyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| InChIKey | ZFCMNIMBEFAUFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NN3C(=NC(=NC3=N2)SC)N |
Computed by PubChem (NCBI)