CAS 189955-79-1 appears in our catalog under these names: 2-Bromo-2-methyl-1-(4-(methylsulfonyl)phenyl)-1-propanone, Firocoxib Impurity 2. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, 1mg, 5mg, on request.
2-bromo-2-methyl-1-(4-methylsulfonylphenyl)propan-1-one (CAS 189955-79-1) is a chemical compound with the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. IUPAC name: 2-bromo-2-methyl-1-(4-methylsulfonylphenyl)propan-1-one. InChIKey: XYJYOXRPGNOGEP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 2-bromo-2-methyl-1-(4-methylsulfonylphenyl)propan-1-one |
| InChIKey | XYJYOXRPGNOGEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=C(C=C1)S(=O)(=O)C)Br |
Computed by PubChem (NCBI)