CAS 2001951-51-3 appears in our catalog under these names: 4-(4-Bromophenoxy)tetrahydro-2H-thiopyran 1,1-dioxide, 95%, 4-​(4-​Bromophenoxy)​tetrahydro-2H-​thiopyran 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(4-bromophenoxy)thiane 1,1-dioxide (CAS 2001951-51-3) is a chemical compound with the molecular formula C11H13BrO3S and a molecular weight of 305.19 g/mol. IUPAC name: 4-(4-bromophenoxy)thiane 1,1-dioxide. InChIKey: PAAFHJDGXKZVNT-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 4-(4-bromophenoxy)thiane 1,1-dioxide |
| InChIKey | PAAFHJDGXKZVNT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)