CAS 18996-04-8 appears in our catalog under these names: 2-(2,5-Dimethylphenoxy)propanoic acid, 95%, 2-(2,5-Dimethylphenoxy)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(2,5-dimethylphenoxy)propanoic acid (CAS 18996-04-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-(2,5-dimethylphenoxy)propanoic acid. InChIKey: MJJBTCMCULRVQR-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(2,5-dimethylphenoxy)propanoic acid |
| InChIKey | MJJBTCMCULRVQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OC(C)C(=O)O |
Computed by PubChem (NCBI)