CAS 1899905-99-7 appears in our catalog under these names: 2-Methyl-4-methylthiophenylboronic acid pinacol ester, 95%, 2-Methyl-4-methylthiophenylboronic acid pinacol ester. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.
4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 1899905-99-7) is a chemical compound with the molecular formula C14H21BO2S and a molecular weight of 264.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: PVXPZIHCLZQKJF-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2S |
|---|---|
| Molecular weight | 264.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | PVXPZIHCLZQKJF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)SC)C |
Computed by PubChem (NCBI)