Products 1923743-75-2
CAS 1923743-75-2 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(4-methyl-2-(methylthio)phenyl)-1,3,2-dioxaborolane, 4-Methyl-2-(methylthio)phenylboronic acid pinacol ester, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
4,4,5,5-tetramethyl-2-(4-methyl-2-methylsulfanylphenyl)-1,3,2-dioxaborolane (CAS 1923743-75-2) is a chemical compound with the molecular formula C14H21BO2S and a molecular weight of 264.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methyl-2-methylsulfanylphenyl)-1,3,2-dioxaborolane. InChIKey: VDMICOJPEXEUMY-UHFFFAOYSA-N.
| Molecular formula | C14H21BO2S |
|---|---|
| Molecular weight | 264.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methyl-2-methylsulfanylphenyl)-1,3,2-dioxaborolane |
| InChIKey | VDMICOJPEXEUMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)SC |
Computed by PubChem (NCBI)