CAS 190190-47-7 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)-4-(thiophen-2-yl)butanoic acid, 96%, (S)–3–((tert–Butoxycarbonyl)amino)–4–(thiophen–2–yl)butanoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid (CAS 190190-47-7) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid. InChIKey: USQYZXFFROGLRS-SECBINFHSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-thiophen-2-ylbutanoic acid |
| InChIKey | USQYZXFFROGLRS-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CS1)CC(=O)O |
Computed by PubChem (NCBI)