Products 1902161-12-9

CAS 1902161-12-9 appears in our catalog under these names: Ppardelta agonist 1, Pparδ agonist 1. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, Get quote.

Structural formula: {0} (CAS {1})

(E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]-4-methylhex-4-enoic acid (CAS 1902161-12-9) is a chemical compound with the molecular formula C26H27NO5 and a molecular weight of 433.5 g/mol. IUPAC name: (E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]-4-methylhex-4-enoic acid. InChIKey: WZFMWAHUFRLQRH-XDJHFCHBSA-N.

Identity
Molecular formulaC26H27NO5
Molecular weight433.5 g/mol
IUPAC name(E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]-4-methylhex-4-enoic acid
InChIKeyWZFMWAHUFRLQRH-XDJHFCHBSA-N
SMILESC/C(=C\COC1=CC=CC=C1CN(C)C(=O)C2=CC=C(C=C2)C3=CC=CO3)/CCC(=O)O

Computed by PubChem (NCBI)